C12H10BrNO5 — CID 102499981
methyl 2-[(1R,2R,3R)-2-(2-bromophenyl)-3-nitrocyclopropyl]-2-oxoacetate (PubChem CID 102499981) has the molecular formula C12H10BrNO5 and a molecular weight of 328.12 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3R)-2-(2-bromophenyl)-3-nitrocyclopropyl]-2-oxoacetate.
| Compound Name | methyl 2-[(1R,2R,3R)-2-(2-bromophenyl)-3-nitrocyclopropyl]-2-oxoacetate |
|---|---|
| PubChem CID | 102499981 |
| Molecular Formula | C12H10BrNO5 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | methyl 2-[(1R,2R,3R)-2-(2-bromophenyl)-3-nitrocyclopropyl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@@H]1[C@H](c2ccccc2Br)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10BrNO5/c1-19-12(16)11(15)9-8(10(9)14(17)18)6-4-2-3-5-7(6)13/h2-5,8-10H,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | YNLMNAWHYRQBBA-IVZWLZJFSA-N |
| XLogP | 1.55 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|