C10H9NO5S — CID 102499979
methyl 2-[(1R,2S,3S)-2-nitro-3-thiophen-2-ylcyclopropyl]-2-oxoacetate (PubChem CID 102499979) has the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. Its IUPAC name is methyl 2-[(1R,2S,3S)-2-nitro-3-thiophen-2-ylcyclopropyl]-2-oxoacetate.
| Compound Name | methyl 2-[(1R,2S,3S)-2-nitro-3-thiophen-2-ylcyclopropyl]-2-oxoacetate |
|---|---|
| PubChem CID | 102499979 |
| Molecular Formula | C10H9NO5S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | methyl 2-[(1R,2S,3S)-2-nitro-3-thiophen-2-ylcyclopropyl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@@H]1[C@H](c2cccs2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO5S/c1-16-10(13)9(12)7-6(8(7)11(14)15)5-3-2-4-17-5/h2-4,6-8H,1H3/t6-,7+,8+/m0/s1 |
| InChIKey | YHPZVPJTKVHOBE-XLPZGREQSA-N |
| XLogP | 0.85 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|