C13H11NO3S2 — CID 102229135
(2R,3R,4R)-3-nitro-2-thiophen-2-yl-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 102229135) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2R,3R,4R)-3-nitro-2-thiophen-2-yl-3,4-dihydro-2H-thiochromen-4-ol.
| Compound Name | (2R,3R,4R)-3-nitro-2-thiophen-2-yl-3,4-dihydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 102229135 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | (2R,3R,4R)-3-nitro-2-thiophen-2-yl-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | O=[N+]([O-])[C@@H]1[C@H](O)c2ccccc2S[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H11NO3S2/c15-12-8-4-1-2-5-9(8)19-13(11(12)14(16)17)10-6-3-7-18-10/h1-7,11-13,15H/t11-,12-,13+/m1/s1 |
| InChIKey | BWBHJQGRTBNIQM-UPJWGTAASA-N |
| XLogP | 3.27 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|