C9H10N2O4 — CID 22320445
3-nitro-1,2,3,4-tetrahydroquinoline-2,4-diol (PubChem CID 22320445) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-nitro-1,2,3,4-tetrahydroquinoline-2,4-diol.
| Compound Name | 3-nitro-1,2,3,4-tetrahydroquinoline-2,4-diol |
|---|---|
| PubChem CID | 22320445 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-nitro-1,2,3,4-tetrahydroquinoline-2,4-diol |
| SMILES | O=[N+]([O-])C1C(O)Nc2ccccc2C1O |
| InChI | InChI=1S/C9H10N2O4/c12-8-5-3-1-2-4-6(5)10-9(13)7(8)11(14)15/h1-4,7-10,12-13H |
| InChIKey | SSROMDLXMIKMGP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|