C15H12BrNO3S — CID 135029191
2-(3-bromophenyl)-3-nitro-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 135029191) has the molecular formula C15H12BrNO3S and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-nitro-3,4-dihydro-2H-thiochromen-4-ol.
| Compound Name | 2-(3-bromophenyl)-3-nitro-3,4-dihydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 135029191 |
| Molecular Formula | C15H12BrNO3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-(3-bromophenyl)-3-nitro-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | O=[N+]([O-])C1C(O)c2ccccc2SC1c1cccc(Br)c1 |
| InChI | InChI=1S/C15H12BrNO3S/c16-10-5-3-4-9(8-10)15-13(17(19)20)14(18)11-6-1-2-7-12(11)21-15/h1-8,13-15,18H |
| InChIKey | DMTHVZONZDDAIZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|