C20H20BrNO4 — CID 122399534
[(1S,2R,5S,6R)-6-(3-bromophenyl)-2-hydroxy-2-methyl-5-nitrocyclohexyl]-phenylmethanone (PubChem CID 122399534) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-6-(3-bromophenyl)-2-hydroxy-2-methyl-5-nitrocyclohexyl]-phenylmethanone.
| Compound Name | [(1S,2R,5S,6R)-6-(3-bromophenyl)-2-hydroxy-2-methyl-5-nitrocyclohexyl]-phenylmethanone |
|---|---|
| PubChem CID | 122399534 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [(1S,2R,5S,6R)-6-(3-bromophenyl)-2-hydroxy-2-methyl-5-nitrocyclohexyl]-phenylmethanone |
| SMILES | C[C@@]1(O)CC[C@H]([N+](=O)[O-])[C@@H](c2cccc(Br)c2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-20(24)11-10-16(22(25)26)17(14-8-5-9-15(21)12-14)18(20)19(23)13-6-3-2-4-7-13/h2-9,12,16-18,24H,10-11H2,1H3/t16-,17+,18+,20+/m0/s1 |
| InChIKey | YLHGCHUJFLDLKH-JRBPQWBISA-N |
| XLogP | 4.22 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|