C27H24O5 — CID 4139170
2,4-dibenzoyl-5-hydroxy-3-(4-hydroxyphenyl)-5-methylcyclohexan-1-one (PubChem CID 4139170) has the molecular formula C27H24O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2,4-dibenzoyl-5-hydroxy-3-(4-hydroxyphenyl)-5-methylcyclohexan-1-one.
| Compound Name | 2,4-dibenzoyl-5-hydroxy-3-(4-hydroxyphenyl)-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 4139170 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2,4-dibenzoyl-5-hydroxy-3-(4-hydroxyphenyl)-5-methylcyclohexan-1-one |
| SMILES | CC1(O)CC(=O)C(C(=O)c2ccccc2)C(c2ccc(O)cc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24O5/c1-27(32)16-21(29)23(25(30)18-8-4-2-5-9-18)22(17-12-14-20(28)15-13-17)24(27)26(31)19-10-6-3-7-11-19/h2-15,22-24,28,32H,16H2,1H3 |
| InChIKey | UUAYAPKZAMEQOZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|