C28H26O4 — CID 124756410
(2S,3S,4S,5R)-2,4-dibenzoyl-5-hydroxy-5-methyl-3-(4-methylphenyl)cyclohexan-1-one (PubChem CID 124756410) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,4-dibenzoyl-5-hydroxy-5-methyl-3-(4-methylphenyl)cyclohexan-1-one.
| Compound Name | (2S,3S,4S,5R)-2,4-dibenzoyl-5-hydroxy-5-methyl-3-(4-methylphenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 124756410 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (2S,3S,4S,5R)-2,4-dibenzoyl-5-hydroxy-5-methyl-3-(4-methylphenyl)cyclohexan-1-one |
| SMILES | Cc1ccc([C@@H]2[C@H](C(=O)c3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26O4/c1-18-13-15-19(16-14-18)23-24(26(30)20-9-5-3-6-10-20)22(29)17-28(2,32)25(23)27(31)21-11-7-4-8-12-21/h3-16,23-25,32H,17H2,1-2H3/t23-,24-,25-,28-/m1/s1 |
| InChIKey | SPFVZACNGAUKRH-PAHOUZJPSA-N |
| XLogP | 4.80 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|