C27H23BrO4 — CID 124718743
(2R,3R,4R,5S)-2,4-dibenzoyl-3-(4-bromophenyl)-5-hydroxy-5-methylcyclohexan-1-one (PubChem CID 124718743) has the molecular formula C27H23BrO4 and a molecular weight of 491.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2,4-dibenzoyl-3-(4-bromophenyl)-5-hydroxy-5-methylcyclohexan-1-one.
| Compound Name | (2R,3R,4R,5S)-2,4-dibenzoyl-3-(4-bromophenyl)-5-hydroxy-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 124718743 |
| Molecular Formula | C27H23BrO4 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (2R,3R,4R,5S)-2,4-dibenzoyl-3-(4-bromophenyl)-5-hydroxy-5-methylcyclohexan-1-one |
| SMILES | C[C@]1(O)CC(=O)[C@H](C(=O)c2ccccc2)[C@H](c2ccc(Br)cc2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23BrO4/c1-27(32)16-21(29)23(25(30)18-8-4-2-5-9-18)22(17-12-14-20(28)15-13-17)24(27)26(31)19-10-6-3-7-11-19/h2-15,22-24,32H,16H2,1H3/t22-,23-,24-,27-/m0/s1 |
| InChIKey | DOMKDVRQFVLOLZ-TTZMFTMZSA-N |
| XLogP | 5.25 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|