C14H14BrNO5 — CID 102336754
methyl (4R)-4-(3-bromophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 102336754) has the molecular formula C14H14BrNO5 and a molecular weight of 356.17 g/mol. Its IUPAC name is methyl (4R)-4-(3-bromophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (4R)-4-(3-bromophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 102336754 |
| Molecular Formula | C14H14BrNO5 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | methyl (4R)-4-(3-bromophenyl)-6-methyl-3-nitro-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | COC(=O)C1=C(C)OCC([N+](=O)[O-])[C@@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C14H14BrNO5/c1-8-12(14(17)20-2)13(11(7-21-8)16(18)19)9-4-3-5-10(15)6-9/h3-6,11,13H,7H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | BVRZGMSEBMXUKY-YUZLPWPTSA-N |
| XLogP | 2.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|