C20H19NO3 — CID 162405889
[(1S,2R,3S)-5-methylidene-2-(4-methylphenyl)-3-nitrocyclopentyl]-phenylmethanone (PubChem CID 162405889) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is [(1S,2R,3S)-5-methylidene-2-(4-methylphenyl)-3-nitrocyclopentyl]-phenylmethanone.
| Compound Name | [(1S,2R,3S)-5-methylidene-2-(4-methylphenyl)-3-nitrocyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 162405889 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(1S,2R,3S)-5-methylidene-2-(4-methylphenyl)-3-nitrocyclopentyl]-phenylmethanone |
| SMILES | C=C1C[C@H]([N+](=O)[O-])[C@@H](c2ccc(C)cc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-13-8-10-15(11-9-13)19-17(21(23)24)12-14(2)18(19)20(22)16-6-4-3-5-7-16/h3-11,17-19H,2,12H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | CPPOULOSTHKQQP-IPMKNSEASA-N |
| XLogP | 4.18 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|