C16H16N2O2 — CID 102344655
(2R,3S)-2-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydroquinoline (PubChem CID 102344655) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (2R,3S)-2-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3S)-2-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 102344655 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R,3S)-2-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc([C@H]2Nc3ccccc3C[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-11-6-8-12(9-7-11)16-15(18(19)20)10-13-4-2-3-5-14(13)17-16/h2-9,15-17H,10H2,1H3/t15-,16+/m0/s1 |
| InChIKey | DVIWPCIRUCFMEZ-JKSUJKDBSA-N |
| XLogP | 3.35 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|