C16H14F3N — CID 122219659
(2R,3S)-2-phenyl-3-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 122219659) has the molecular formula C16H14F3N and a molecular weight of 277.29 g/mol. Its IUPAC name is (2R,3S)-2-phenyl-3-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3S)-2-phenyl-3-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 122219659 |
| Molecular Formula | C16H14F3N |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2R,3S)-2-phenyl-3-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | FC(F)(F)[C@H]1Cc2ccccc2N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H14F3N/c17-16(18,19)13-10-12-8-4-5-9-14(12)20-15(13)11-6-2-1-3-7-11/h1-9,13,15,20H,10H2/t13-,15-/m0/s1 |
| InChIKey | QWWXIHPYEKBMOR-ZFWWWQNUSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |