C12H14F3N — CID 95374690
(2S,3S)-2-phenyl-3-(trifluoromethyl)piperidine (PubChem CID 95374690) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3-(trifluoromethyl)piperidine.
| Compound Name | (2S,3S)-2-phenyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 95374690 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (2S,3S)-2-phenyl-3-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)[C@H]1CCCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H14F3N/c13-12(14,15)10-7-4-8-16-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11,16H,4,7-8H2/t10-,11+/m0/s1 |
| InChIKey | PEHNCKYQVJGIEF-WDEREUQCSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |