C13H13F6NO — CID 106778899
2-[3-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)piperidine (PubChem CID 106778899) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 106778899 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)Oc1cccc(C2NCCCC2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO/c14-12(15,16)10-5-2-6-20-11(10)8-3-1-4-9(7-8)21-13(17,18)19/h1,3-4,7,10-11,20H,2,5-6H2 |
| InChIKey | LGJSLDQGCQKCRY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |