C18H15F6NO — CID 87580183
2-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 87580183) has the molecular formula C18H15F6NO and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 87580183 |
| Molecular Formula | C18H15F6NO |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)Oc1cccc(C2CCC(c3ccc(C(F)(F)F)cc3)N2)c1 |
| InChI | InChI=1S/C18H15F6NO/c19-17(20,21)13-6-4-11(5-7-13)15-8-9-16(25-15)12-2-1-3-14(10-12)26-18(22,23)24/h1-7,10,15-16,25H,8-9H2 |
| InChIKey | NUKFAPVKDHZCOR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |