C11H12F3NOS — CID 107105145
5-methyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidine (PubChem CID 107105145) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is 5-methyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidine.
| Compound Name | 5-methyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 107105145 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-methyl-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidine |
| SMILES | CC1CNC(c2cccc(OC(F)(F)F)c2)S1 |
| InChI | InChI=1S/C11H12F3NOS/c1-7-6-15-10(17-7)8-3-2-4-9(5-8)16-11(12,13)14/h2-5,7,10,15H,6H2,1H3 |
| InChIKey | QZKMSXDEDOROBC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |