C17H19NO — CID 97356138
(2S,3R)-3-phenoxy-2-phenylpiperidine (PubChem CID 97356138) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (2S,3R)-3-phenoxy-2-phenylpiperidine.
| Compound Name | (2S,3R)-3-phenoxy-2-phenylpiperidine |
|---|---|
| PubChem CID | 97356138 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2S,3R)-3-phenoxy-2-phenylpiperidine |
| SMILES | c1ccc(O[C@@H]2CCCN[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO/c1-3-8-14(9-4-1)17-16(12-7-13-18-17)19-15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/t16-,17+/m1/s1 |
| InChIKey | NMSLARHWBMBDOA-SJORKVTESA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |