C11H17N2+ — CID 59904937
[(2R,3R)-2-phenylpiperidin-3-yl]azanium (PubChem CID 59904937) has the molecular formula C11H17N2+ and a molecular weight of 177.27 g/mol. Its IUPAC name is [(2R,3R)-2-phenylpiperidin-3-yl]azanium.
| Compound Name | [(2R,3R)-2-phenylpiperidin-3-yl]azanium |
|---|---|
| PubChem CID | 59904937 |
| Molecular Formula | C11H17N2+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | [(2R,3R)-2-phenylpiperidin-3-yl]azanium |
| SMILES | [NH3+][C@@H]1CCCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H16N2/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11,13H,4,7-8,12H2/p+1/t10-,11-/m1/s1 |
| InChIKey | GFMAFYNUQDLPBP-GHMZBOCLSA-O |
| XLogP | 0.72 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |