C18H19N — CID 101001721
2-(4-methylphenyl)-1,2,2a,3,4,5-hexahydrobenzo[cd]indole (PubChem CID 101001721) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,2,2a,3,4,5-hexahydrobenzo[cd]indole.
| Compound Name | 2-(4-methylphenyl)-1,2,2a,3,4,5-hexahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 101001721 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(4-methylphenyl)-1,2,2a,3,4,5-hexahydrobenzo[cd]indole |
| SMILES | Cc1ccc(C2Nc3cccc4c3C2CCC4)cc1 |
| InChI | InChI=1S/C18H19N/c1-12-8-10-14(11-9-12)18-15-6-2-4-13-5-3-7-16(19-18)17(13)15/h3,5,7-11,15,18-19H,2,4,6H2,1H3 |
| InChIKey | BJEJIPKYCUJWSI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |