C11H13N — CID 21476735
1,2,2a,3,4,5-hexahydrobenzo[cd]indole (PubChem CID 21476735) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,2,2a,3,4,5-hexahydrobenzo[cd]indole.
| Compound Name | 1,2,2a,3,4,5-hexahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 21476735 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,2,2a,3,4,5-hexahydrobenzo[cd]indole |
| SMILES | c1cc2c3c(c1)NCC3CCC2 |
| InChI | InChI=1S/C11H13N/c1-3-8-4-2-6-10-11(8)9(5-1)7-12-10/h2,4,6,9,12H,1,3,5,7H2 |
| InChIKey | MFVFAPQCEUCUSG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |