C15H20O — CID 67901360
2-(2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl)ethanol (PubChem CID 67901360) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl)ethanol.
| Compound Name | 2-(2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl)ethanol |
|---|---|
| PubChem CID | 67901360 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-(2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl)ethanol |
| SMILES | OCCC1CCC2CCCc3cccc1c32 |
| InChI | InChI=1S/C15H20O/c16-10-9-11-7-8-13-4-1-3-12-5-2-6-14(11)15(12)13/h2,5-6,11,13,16H,1,3-4,7-10H2 |
| InChIKey | BLKIONNFVMZXMQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |