C18H23NO — CID 10849602
1-[(1R,3aR)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]piperidin-4-one (PubChem CID 10849602) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-[(1R,3aR)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]piperidin-4-one.
| Compound Name | 1-[(1R,3aR)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]piperidin-4-one |
|---|---|
| PubChem CID | 10849602 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1-[(1R,3aR)-2,3,3a,4,5,6-hexahydro-1H-phenalen-1-yl]piperidin-4-one |
| SMILES | O=C1CCN([C@@H]2CC[C@H]3CCCc4cccc2c43)CC1 |
| InChI | InChI=1S/C18H23NO/c20-15-9-11-19(12-10-15)17-8-7-14-4-1-3-13-5-2-6-16(17)18(13)14/h2,5-6,14,17H,1,3-4,7-12H2/t14-,17-/m1/s1 |
| InChIKey | GPMJPYDKWWYFIF-RHSMWYFYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |