C13H17N — CID 63823189
tricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine (PubChem CID 63823189) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is tricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine.
| Compound Name | tricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine |
|---|---|
| PubChem CID | 63823189 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | tricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-3-amine |
| SMILES | NC1CC2CCCCc3cccc1c32 |
| InChI | InChI=1S/C13H17N/c14-12-8-10-5-2-1-4-9-6-3-7-11(12)13(9)10/h3,6-7,10,12H,1-2,4-5,8,14H2 |
| InChIKey | PAOYRVBSSVHAEI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |