C10H12FN — CID 84717070
3-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 84717070) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 84717070 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | FC1CCc2ccccc2NC1 |
| InChI | InChI=1S/C10H12FN/c11-9-6-5-8-3-1-2-4-10(8)12-7-9/h1-4,9,12H,5-7H2 |
| InChIKey | CRFHSYXRJBWYRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |