C13H13F6NO — CID 103314422
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314422) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314422 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | FC(F)(F)C(OC1CCc2ccccc2NC1)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO/c14-12(15,16)11(13(17,18)19)21-9-6-5-8-3-1-2-4-10(8)20-7-9/h1-4,9,11,20H,5-7H2 |
| InChIKey | OUNBXIJFNCWGRO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |