C16H15BrFNO — CID 103314408
3-(3-bromo-4-fluorophenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314408) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-(3-bromo-4-fluorophenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314408 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 3-(3-bromo-4-fluorophenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | Fc1ccc(OC2CCc3ccccc3NC2)cc1Br |
| InChI | InChI=1S/C16H15BrFNO/c17-14-9-12(7-8-15(14)18)20-13-6-5-11-3-1-2-4-16(11)19-10-13/h1-4,7-9,13,19H,5-6,10H2 |
| InChIKey | VFPFOSXLXIRSPS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |