C18H21NO2 — CID 103314356
3-(3-ethoxyphenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314356) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-(3-ethoxyphenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-(3-ethoxyphenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314356 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-(3-ethoxyphenoxy)-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | CCOc1cccc(OC2CCc3ccccc3NC2)c1 |
| InChI | InChI=1S/C18H21NO2/c1-2-20-15-7-5-8-16(12-15)21-17-11-10-14-6-3-4-9-18(14)19-13-17/h3-9,12,17,19H,2,10-11,13H2,1H3 |
| InChIKey | XCRBHIAAYFBGOP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |