C16H23NO2S — CID 106513084
3-cyclohexylsulfonyl-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 106513084) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-cyclohexylsulfonyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-cyclohexylsulfonyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 106513084 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-cyclohexylsulfonyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | O=S(=O)(C1CCCCC1)C1CCc2ccccc2NC1 |
| InChI | InChI=1S/C16H23NO2S/c18-20(19,14-7-2-1-3-8-14)15-11-10-13-6-4-5-9-16(13)17-12-15/h4-6,9,14-15,17H,1-3,7-8,10-12H2 |
| InChIKey | RVDAZOZRWSTVSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |