C16H17NS — CID 103314427
3-phenylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 103314427) has the molecular formula C16H17NS and a molecular weight of 255.39 g/mol. Its IUPAC name is 3-phenylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | 3-phenylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 103314427 |
| Molecular Formula | C16H17NS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-phenylsulfanyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | c1ccc(SC2CCc3ccccc3NC2)cc1 |
| InChI | InChI=1S/C16H17NS/c1-2-7-14(8-3-1)18-15-11-10-13-6-4-5-9-16(13)17-12-15/h1-9,15,17H,10-12H2 |
| InChIKey | ZWMHUHMMZFWLKY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |