About 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine
3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 84718220) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
Analyze 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine?
The IUPAC name of 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine (CID 84718220) is 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
What is the SMILES notation for 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine?
The canonical SMILES for 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine is Cc1ccc2c(c1)CCC(F)CN2.
What is the InChIKey of 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine?
The InChIKey is CTLBATUIFLUNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-8-2-5-11-9(6-8)3-4-10(12)7-13-11/h2,5-6,10,13H,3-4,7H2,1H3.
What are the key properties of 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine?
3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine has a molecular weight of 179.24 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-7-methyl-2,3,4,5-tetrahydro-1H-1-benzazepine is sourced from PubChem (CID 84718220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).