C17H27N3O2S — CID 141150383
1-[(2,4-dihydroxy-1,2,3,4-tetrahydroquinolin-3-yl)methyl]-3-hexylthiourea (PubChem CID 141150383) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[(2,4-dihydroxy-1,2,3,4-tetrahydroquinolin-3-yl)methyl]-3-hexylthiourea.
| Compound Name | 1-[(2,4-dihydroxy-1,2,3,4-tetrahydroquinolin-3-yl)methyl]-3-hexylthiourea |
|---|---|
| PubChem CID | 141150383 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[(2,4-dihydroxy-1,2,3,4-tetrahydroquinolin-3-yl)methyl]-3-hexylthiourea |
| SMILES | CCCCCCNC(=S)NCC1C(O)Nc2ccccc2C1O |
| InChI | InChI=1S/C17H27N3O2S/c1-2-3-4-7-10-18-17(23)19-11-13-15(21)12-8-5-6-9-14(12)20-16(13)22/h5-6,8-9,13,15-16,20-22H,2-4,7,10-11H2,1H3,(H2,18,19,23) |
| InChIKey | WVFLUPUNDPQJBT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|