C21H25FN2O5S — CID 67158501
methyl (2S,3R,4S,5S)-3-[(1S)-1-[(2-fluorophenyl)methoxy]-2-methylpropyl]-4-nitro-5-thiophen-2-ylpyrrolidine-2-carboxylate (PubChem CID 67158501) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S)-3-[(1S)-1-[(2-fluorophenyl)methoxy]-2-methylpropyl]-4-nitro-5-thiophen-2-ylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S)-3-[(1S)-1-[(2-fluorophenyl)methoxy]-2-methylpropyl]-4-nitro-5-thiophen-2-ylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67158501 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl (2S,3R,4S,5S)-3-[(1S)-1-[(2-fluorophenyl)methoxy]-2-methylpropyl]-4-nitro-5-thiophen-2-ylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@H](c2cccs2)[C@@H]([N+](=O)[O-])[C@@H]1[C@@H](OCc1ccccc1F)C(C)C |
| InChI | InChI=1S/C21H25FN2O5S/c1-12(2)20(29-11-13-7-4-5-8-14(13)22)16-18(21(25)28-3)23-17(19(16)24(26)27)15-9-6-10-30-15/h4-10,12,16-20,23H,11H2,1-3H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | PYXJEVWBYGKBKQ-SLHNCBLASA-N |
| XLogP | 3.58 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|