C26H32FN3O6 — CID 16718113
3-[[(2S,3R,4S,5S)-3-[(2S)-1-[(2-fluorophenyl)methoxy]-2-methylbutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 16718113) has the molecular formula C26H32FN3O6 and a molecular weight of 501.56 g/mol. Its IUPAC name is 3-[[(2S,3R,4S,5S)-3-[(2S)-1-[(2-fluorophenyl)methoxy]-2-methylbutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[(2S,3R,4S,5S)-3-[(2S)-1-[(2-fluorophenyl)methoxy]-2-methylbutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 16718113 |
| Molecular Formula | C26H32FN3O6 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 3-[[(2S,3R,4S,5S)-3-[(2S)-1-[(2-fluorophenyl)methoxy]-2-methylbutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CC[C@H](C)C(OCc1ccccc1F)[C@H]1[C@H]([N+](=O)[O-])[C@H](c2ccccc2)N[C@@H]1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C26H32FN3O6/c1-3-16(2)25(36-15-18-11-7-8-12-19(18)27)21-23(26(33)28-14-13-20(31)32)29-22(24(21)30(34)35)17-9-5-4-6-10-17/h4-12,16,21-25,29H,3,13-15H2,1-2H3,(H,28,33)(H,31,32)/t16-,21+,22-,23-,24-,25?/m0/s1 |
| InChIKey | CZMTZDPKVJDETM-WNXXVYOASA-N |
| XLogP | 3.32 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|