C29H38N4O7 — CID 71562758
3-[[(2S,3S,4S,5S)-1-(2-aminoacetyl)-2-methyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 71562758) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is 3-[[(2S,3S,4S,5S)-1-(2-aminoacetyl)-2-methyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[(2S,3S,4S,5S)-1-(2-aminoacetyl)-2-methyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 71562758 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 3-[[(2S,3S,4S,5S)-1-(2-aminoacetyl)-2-methyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitro-5-phenylpyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CC[C@H](C)[C@H](OCc1ccccc1)[C@H]1[C@H]([N+](=O)[O-])[C@H](c2ccccc2)N(C(=O)CN)[C@]1(C)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C29H38N4O7/c1-4-19(2)27(40-18-20-11-7-5-8-12-20)24-26(33(38)39)25(21-13-9-6-10-14-21)32(22(34)17-30)29(24,3)28(37)31-16-15-23(35)36/h5-14,19,24-27H,4,15-18,30H2,1-3H3,(H,31,37)(H,35,36)/t19-,24+,25-,26-,27-,29-/m0/s1 |
| InChIKey | FUELQTGWYFWOJC-POVNMVQCSA-N |
| XLogP | 2.77 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|