C22H31N3O6 — CID 11350990
2-[[(2S,3R,4S,5S)-5-cyclopropyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitropyrrolidine-2-carbonyl]amino]acetic acid (PubChem CID 11350990) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[[(2S,3R,4S,5S)-5-cyclopropyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitropyrrolidine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(2S,3R,4S,5S)-5-cyclopropyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitropyrrolidine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 11350990 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[[(2S,3R,4S,5S)-5-cyclopropyl-3-[(1S,2S)-2-methyl-1-phenylmethoxybutyl]-4-nitropyrrolidine-2-carbonyl]amino]acetic acid |
| SMILES | CC[C@H](C)[C@H](OCc1ccccc1)[C@H]1[C@H]([N+](=O)[O-])[C@H](C2CC2)N[C@@H]1C(=O)NCC(=O)O |
| InChI | InChI=1S/C22H31N3O6/c1-3-13(2)21(31-12-14-7-5-4-6-8-14)17-19(22(28)23-11-16(26)27)24-18(15-9-10-15)20(17)25(29)30/h4-8,13,15,17-21,24H,3,9-12H2,1-2H3,(H,23,28)(H,26,27)/t13-,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | UXCPHGWNWXEYBQ-HZTATPIOSA-N |
| XLogP | 1.83 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|