C23H29N3O7 — CID 67157918
3-[[(2S,3R,4S,5S)-5-(furan-2-yl)-3-(2-methyl-1-phenylmethoxypropyl)-4-nitropyrrolidine-2-carbonyl]amino]propanoic acid (PubChem CID 67157918) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[[(2S,3R,4S,5S)-5-(furan-2-yl)-3-(2-methyl-1-phenylmethoxypropyl)-4-nitropyrrolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[(2S,3R,4S,5S)-5-(furan-2-yl)-3-(2-methyl-1-phenylmethoxypropyl)-4-nitropyrrolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67157918 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-[[(2S,3R,4S,5S)-5-(furan-2-yl)-3-(2-methyl-1-phenylmethoxypropyl)-4-nitropyrrolidine-2-carbonyl]amino]propanoic acid |
| SMILES | CC(C)C(OCc1ccccc1)[C@H]1[C@H]([N+](=O)[O-])[C@@H](c2ccco2)N[C@@H]1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C23H29N3O7/c1-14(2)22(33-13-15-7-4-3-5-8-15)18-20(23(29)24-11-10-17(27)28)25-19(21(18)26(30)31)16-9-6-12-32-16/h3-9,12,14,18-22,25H,10-11,13H2,1-2H3,(H,24,29)(H,27,28)/t18-,19-,20+,21+,22?/m1/s1 |
| InChIKey | UHEQJTPUUCEOFH-RPKDUVEISA-N |
| XLogP | 2.39 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|