C10H10FNO3 — CID 16785853
2-[[2-(2-fluorophenyl)acetyl]amino]acetic acid (PubChem CID 16785853) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is 2-[[2-(2-fluorophenyl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-fluorophenyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 16785853 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-[[2-(2-fluorophenyl)acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C10H10FNO3/c11-8-4-2-1-3-7(8)5-9(13)12-6-10(14)15/h1-4H,5-6H2,(H,12,13)(H,14,15) |
| InChIKey | IWZWQSNULUCNSH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |