C15H18FN3O3 — CID 112991834
2-(2-fluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide (PubChem CID 112991834) has the molecular formula C15H18FN3O3 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 112991834 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide |
| SMILES | O=CN1CCN(C(=O)CNC(=O)Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C15H18FN3O3/c16-13-4-2-1-3-12(13)9-14(21)17-10-15(22)19-7-5-18(11-20)6-8-19/h1-4,11H,5-10H2,(H,17,21) |
| InChIKey | DDMIPZNGKMWABS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|