C14H16FN3O3 — CID 108944765
N-(2-fluorophenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108944765) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-(2-fluorophenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108944765 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | O=CN1CCN(C(=O)CC(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C14H16FN3O3/c15-11-3-1-2-4-12(11)16-13(20)9-14(21)18-7-5-17(10-19)6-8-18/h1-4,10H,5-9H2,(H,16,20) |
| InChIKey | VSYOCWSBEPRKAS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|