C15H17F2N3O3 — CID 108945020
3-(4-acetylpiperazin-1-yl)-N-(2,6-difluorophenyl)-3-oxopropanamide (PubChem CID 108945020) has the molecular formula C15H17F2N3O3 and a molecular weight of 325.31 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-N-(2,6-difluorophenyl)-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-N-(2,6-difluorophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108945020 |
| Molecular Formula | C15H17F2N3O3 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-N-(2,6-difluorophenyl)-3-oxopropanamide |
| SMILES | CC(=O)N1CCN(C(=O)CC(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C15H17F2N3O3/c1-10(21)19-5-7-20(8-6-19)14(23)9-13(22)18-15-11(16)3-2-4-12(15)17/h2-4H,5-9H2,1H3,(H,18,22) |
| InChIKey | LVKQKDFWVASANF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|