C16H21N3O3 — CID 108944753
N-(2,3-dimethylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108944753) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108944753 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | Cc1cccc(NC(=O)CC(=O)N2CCN(C=O)CC2)c1C |
| InChI | InChI=1S/C16H21N3O3/c1-12-4-3-5-14(13(12)2)17-15(21)10-16(22)19-8-6-18(11-20)7-9-19/h3-5,11H,6-10H2,1-2H3,(H,17,21) |
| InChIKey | SSWLXGZFLSEVKH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|