C22H33N3O2 — CID 50983685
N-(2,3-dimethylphenyl)-3-oxo-3-[4-(1-pyrrolidin-1-ylethyl)piperidin-1-yl]propanamide (PubChem CID 50983685) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-oxo-3-[4-(1-pyrrolidin-1-ylethyl)piperidin-1-yl]propanamide.
| Compound Name | N-(2,3-dimethylphenyl)-3-oxo-3-[4-(1-pyrrolidin-1-ylethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 50983685 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-oxo-3-[4-(1-pyrrolidin-1-ylethyl)piperidin-1-yl]propanamide |
| SMILES | Cc1cccc(NC(=O)CC(=O)N2CCC(C(C)N3CCCC3)CC2)c1C |
| InChI | InChI=1S/C22H33N3O2/c1-16-7-6-8-20(17(16)2)23-21(26)15-22(27)25-13-9-19(10-14-25)18(3)24-11-4-5-12-24/h6-8,18-19H,4-5,9-15H2,1-3H3,(H,23,26) |
| InChIKey | ZLMLAZDSAXEULW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|