C18H25N3O3 — CID 108944764
N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108944764) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108944764 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-(4-formylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CC(=O)N2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,3)14-4-6-15(7-5-14)19-16(23)12-17(24)21-10-8-20(13-22)9-11-21/h4-7,13H,8-12H2,1-3H3,(H,19,23) |
| InChIKey | YCBAYVHMRGHILH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|