C16H19N3O5 — CID 108944799
methyl 3-[[3-(4-formylpiperazin-1-yl)-3-oxopropanoyl]amino]benzoate (PubChem CID 108944799) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 3-[[3-(4-formylpiperazin-1-yl)-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(4-formylpiperazin-1-yl)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108944799 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | methyl 3-[[3-(4-formylpiperazin-1-yl)-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CC(=O)N2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C16H19N3O5/c1-24-16(23)12-3-2-4-13(9-12)17-14(21)10-15(22)19-7-5-18(11-20)6-8-19/h2-4,9,11H,5-8,10H2,1H3,(H,17,21) |
| InChIKey | BBXCHNAOXQTGFZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|