C16H21N3O4 — CID 109018056
methyl 3-[3-(4-formylpiperazin-1-yl)propanoylamino]benzoate (PubChem CID 109018056) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 3-[3-(4-formylpiperazin-1-yl)propanoylamino]benzoate.
| Compound Name | methyl 3-[3-(4-formylpiperazin-1-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 109018056 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | methyl 3-[3-(4-formylpiperazin-1-yl)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCN2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C16H21N3O4/c1-23-16(22)13-3-2-4-14(11-13)17-15(21)5-6-18-7-9-19(12-20)10-8-18/h2-4,11-12H,5-10H2,1H3,(H,17,21) |
| InChIKey | ISCBZEZTNRJEPE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|