C19H20N2O4 — CID 39769177
methyl 3-(4-benzamidobutanoylamino)benzoate (PubChem CID 39769177) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 3-(4-benzamidobutanoylamino)benzoate.
| Compound Name | methyl 3-(4-benzamidobutanoylamino)benzoate |
|---|---|
| PubChem CID | 39769177 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl 3-(4-benzamidobutanoylamino)benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCCNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-25-19(24)15-9-5-10-16(13-15)21-17(22)11-6-12-20-18(23)14-7-3-2-4-8-14/h2-5,7-10,13H,6,11-12H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | XPGXLPDFDZOVQG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|