C19H20N4O4 — CID 109208822
methyl 3-[[2-(4-formylpiperazine-1-carbonyl)-4-pyridinyl]amino]benzoate (PubChem CID 109208822) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl 3-[[2-(4-formylpiperazine-1-carbonyl)-4-pyridinyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(4-formylpiperazine-1-carbonyl)-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109208822 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | methyl 3-[[2-(4-formylpiperazine-1-carbonyl)-4-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ccnc(C(=O)N3CCN(C=O)CC3)c2)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-27-19(26)14-3-2-4-15(11-14)21-16-5-6-20-17(12-16)18(25)23-9-7-22(13-24)8-10-23/h2-6,11-13H,7-10H2,1H3,(H,20,21) |
| InChIKey | BAHPBODKYUTDGG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|