C22H19N3O3 — CID 109219554
methyl 3-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzoate (PubChem CID 109219554) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 3-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109219554 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | methyl 3-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2ccnc(C(=O)N3CCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C22H19N3O3/c1-28-22(27)16-6-4-7-17(13-16)24-18-9-11-23-19(14-18)21(26)25-12-10-15-5-2-3-8-20(15)25/h2-9,11,13-14H,10,12H2,1H3,(H,23,24) |
| InChIKey | CCXOGOSLDNCFNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |