C21H16N4O — CID 109219573
4-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzonitrile (PubChem CID 109219573) has the molecular formula C21H16N4O and a molecular weight of 340.39 g/mol. Its IUPAC name is 4-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzonitrile.
| Compound Name | 4-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzonitrile |
|---|---|
| PubChem CID | 109219573 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 4-[[2-(2,3-dihydroindole-1-carbonyl)-4-pyridinyl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ccnc(C(=O)N3CCc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C21H16N4O/c22-14-15-5-7-17(8-6-15)24-18-9-11-23-19(13-18)21(26)25-12-10-16-3-1-2-4-20(16)25/h1-9,11,13H,10,12H2,(H,23,24) |
| InChIKey | OLBXXTVJCNZFBO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |